List of top Chemistry Questions on Organic Chemistry asked in WBJEE

Which of the following statement(s) is/are correct about the given compound?

Arrange the following compounds in order of their increasing acid strength

In the following reaction, the major product (H) is

Which of the following compounds is most reactive in S$_N$1 reaction?

Which one among the following compounds will most readily be dehydrated under acidic condition?
 

(A)(B)(C)(D)
CH3-CH2-CH2-OHCH3-CH(CH3)-CH2-OHCH3-CH2-CH(CH3)-OHC(CH3)(CH3)-CH2-OH
(1° alcohol)(2° alcohol)(2° alcohol)(3° alcohol)
The correct acidity order of phenol (I), 4-hydroxybenzaldehyde (II), and 3-hydroxybenzaldehyde (III) is:
In the following sequence of reactions, compound 'M' is:

\( \text{M} \xrightarrow{\text{CH}_3\text{MgBr}} \text{N} + \text{CH}_4 \uparrow \xrightarrow{\text{H}^+} \text{CH}_3\text{COCH}_2\text{COCH}_3 \)